Benperidol (Standard) | MedChemExpress (MCE)
Benperidol (Standard) is the analytical standard of Benperidol. This product is intended for research and analytical applications. Benperidol is a relatively old antipsychotic agent. Benperidol is a butyrophenone antipsychotic, with the highest neuroleptic potency in terms of D2 receptor blockade[1].
| Trivial name | Benperidol (Standard) |
| Catalog Number | HY-121276R |
| Research Area | Neurological Disease |
| CAS# | 2062-84-2 |
| Purity | ≥98.0% |
| SMILES | O=C1NC2=CC=CC=C2N1C3CCN(CC3)CCCC(C4=CC=C(C=C4)F)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/benperidol-standard.html |