Tenofovir Hydrate
Tenofovir is a nucleotide analogue reverse transcriptase inhibitors (NRTIs) which reduces the viral cytopathic effect of HIV-1 (IIIB), HIV-2(ROD) with EC50 of 1.15 μg/ml and 1.12 μg/ml.
| Trivial name | GS 1278 Hydrate; PMPA Hydrate; TDF Hydrate |
| Catalog Number | CSN10187 |
| Alternative Name(s) | GS 1278 Hydrate; PMPA Hydrate; TDF Hydrate |
| Research Area | Infection |
| Molecular Formula | C9H16N5O5P |
| CAS# | 206184-49-8 |
| Purity | ≥98% |
| SMILES | NC1=NC=NC2=C1N=CN2C[C@H](OCP(O)(O)=O)C.[H]O[H] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tenofovir-hydrate.html |