Clozapine D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15695 |
| Alternative Name(s) | 6‐chloro‐10‐[4‐methyl(2,2,6,6‐D4)piperazin‐1‐yl]‐ 2,9‐diazatricyclo[9.4.0.0]pentadeca‐1(15),3,5,7,9,11,13‐heptaene ; Clozapine-D4 |
| Research Area | Labeled Clozapine, intended for use as an internal standard for the quantification of Clozapine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H15D4ClN4 |
| CAS# | 204395-52-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1CC([2H])([2H])N(C2=NC(C=C(Cl)C=C3)=C3NC4=CC=CC=C24)C([2H])([2H])C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15695.html |
| Additional Information | NULL |