Oseltamivir D3 Phosphate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03329 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Oseltamivir, intended for use as an internal standard for the quantification of Oseltamivir by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H28N2O4 |
| CAS# | 204255-11-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[P](O)(O)O.CCC(CC)O[C@H](C=C(C(OCC)=O)C[C@@H]1N)[C@@H]1NC(C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03329.html |
| Additional Information | NULL |