KRAS inhibitor-22 | MedChemExpress (MCE)
KRAS inhibitor-22 (compound FB9/6B9) is a potent inhibitor of K-Ras. KRAS inhibitor-22 targets to Kras 4B(G12D) and (G12C), which can be used for cancer research[1].
| Trivial name | KRAS inhibitor-22 |
| Catalog Number | HY-153412 |
| Research Area | Cancer |
| CAS# | 2042365-57-9 |
| Purity | ≥98.00% |
| SMILES | O=C(N1C[C@H](CCC1)C(NCC(COC2=C(C(F)=CC(F)=C2F)F)=O)=O)C3=C(C=CC(Cl)=C3)OC |
| PubChem Chemical Structure ID | 122674123 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kras-inhibitor-22.html |