SNAC
Salcaprozate Sodium is the sodium salt form of salcaprozate, an oral absorption promoter. Salcaprozate sodium may be used as a delivery agent to promote the oral absorption of certain macromolecules with poor bioavailability such as insulin and heparin.
| Catalog Number | INT203787911 |
| Alternative Name(s) | Salcaprozate sodium sodium 8-(2-hydroxybenzamido)octanoate E414 |
| Research Area | Intermediates |
| Molecular Formula | C15H20NNaO4 |
| CAS# | 203787-91-1 |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/snac-item-9176.html |