(+)-Limonene oxide, mixture of cis and trans
Limonene oxide, also known as limonene 1,2-epoxide, is a monoterpene that can be prepared from limonene. It has antinociceptive and antitumoral activities and is used in many products like food additives, cosmetics, and perfumes.
| Catalog Number | CBB1112641 |
| Molecular Formula | C10H16O |
| CAS# | 203719-54-4 |
| Purity | >97% |
| Inchi | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1 |
| Inchi Key | CCEFMUBVSUDRLG-XNWIYYODSA-N |
| SMILES | CC(=C)[C@@H]1CCC2(C)OC2C1 |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/limonene-oxide-mixture-of-cis-and-trans-item-112641.html |
