(+)-Limonene 1,2-epoxide
(+)-Limonene 1,2-epoxide, a monoterpene that can be prepared from (+)-limonene. It shows potent antinociceptive and antitumoral activity and is mainly used as a building block in synthesis of pharmaceutical products, perfumes, cosmetics and food additives.
| Catalog Number | CBB1112504 |
| Alternative Name(s) | (+)-p-Mentha-1,8-diene 1,2-epoxide; (4R)-1,2-Epoxy-p-menth-8-ene; (+)-Limonene epoxide; (4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide |
| Molecular Formula | C10H16O |
| CAS# | 203719-54-4 |
| Purity | >97% |
| Inchi | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1 |
| Inchi Key | CCEFMUBVSUDRLG-XNWIYYODSA-N |
| SMILES | CC(=C)[C@@H]1CCC2(C)OC2C1 |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/limonene-12-epoxide-item-112504.html |
