Dopamine-d4 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-53968 |
| Alternative Name(s) | 4-(2-Aminoethyl-d4)-1,2-benzenediolloride; |
| Research Area | Labelled Dopamine. Endogenous catecholamine with a and ß-adrenergic activity. Cardiotonic; antihypotensive. |
| Molecular Formula | C8H8D4ClNO2 |
| CAS# | 203633-19-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])C([2H])([2H])C1=CC(O)=C(O)C=C1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST53968.html |
| Additional Information | NULL |