Brefeldin A
Brefeldin A inhibits protein translocation from the endoplasmic reticulum (ER) to the Golgi apparatus reversibly, can be used to induce autophagy in mammalian cells.
| Trivial name | Ascotoxin; Cyanein; Decumbin; Nectrolide |
| Catalog Number | CSN10482 |
| Alternative Name(s) | Ascotoxin; Cyanein; Decumbin; Nectrolide |
| Research Area | Cancer |
| Molecular Formula | C16H24O4 |
| CAS# | 20350-15-6 |
| Purity | ≥99% |
| SMILES | O[C@@H]1C[C@]2([H])[C@@](/C=C/CCC[C@H](C)OC(/C=C/[C@H]2O)=O)([H])C1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/brefeldin-a.html |