Procyanidin
Proanthocyanidins is an antioxidants that remove harmful free oxygen radicals from cells, can be used in the treatment of chronic venous insufficiency, capillary fragility, sunburn and retinopathy.
| Trivial name | condensed tannins;Proanthocyanidins |
| Catalog Number | CSN20943 |
| Alternative Name(s) | condensed tannins;Proanthocyanidins |
| Research Area | / |
| Molecular Formula | C30H26O13 |
| CAS# | 20347-71-1 |
| Purity | ≥95% |
| SMILES | OC1C(C2=CC=C(C(O)=C2)O)(OC3=C(C1O)C(O)=CC(O)=C3)OC4C(OC5=C(C4)C(O)=CC(O)=C5)C6=CC=C(C(O)=C6)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/procyanidin.html |
