Tiliroside 2mg
Tiliroside, a glycosidic flavonoid, ameliorates obesity-induced metabolic disorders via activation of adiponectin signaling followed by enhancement of fatty acid oxidation in liver and skeletal muscle in obese-diabetic mice.
| Trivial name | Tiliroside 2mg |
| Catalog Number | A12131-2 |
| Alternative Name(s) | N/A |
| Molecular Formula | C30H26O13 |
| CAS# | 20316-62-5 |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
| Size | 2mg |
| Supplier Page | http://www.adooq.com/tiliroside.html |
