(S)-2-Hydroxy-3-phenylpropanoic acid
(S)-2-Hydroxy-3-phenylpropanoic acid (L-(-)-3-Phenyllactic acid, (2S)-2-Hydroxy-3-phenylpropanoic acid) is a valuable building block in the pharmaceutical and chemical industry—has recently emerged as an important monomer in the composition of the novel degradable biocompatible material of polyphenyllactic acid.
| Trivial name | L-(-)-3-Phenyllactic acid, (2S)-2-Hydroxy-3-phenylpropanoic acid |
| Catalog Number | S6271 |
| Molecular Formula | C9H10O3 |
| CAS# | 20312-36-1 |
| Inchi | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
| Inchi Key | VOXXWSYKYCBWHO-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/s-2-hydroxy-3-phenylpropanoic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/hydroxy-3-phenylpropanoic-acid-chemical-structure-s6271.gif |