Rosmarinic acid
(R)-rosmarinic acid is a stereoisomer of rosmarinic acid having (R)-configuration. It has a role as a plant metabolite and a geroprotector. It is a conjugate acid of a (R)-rosmarinate. It is an enantiomer of a (S)-rosmarinic acid.
| Catalog Number | PIPE-0563 |
| Alternative Name(s) | Rosemary acid Labiatenic acid Rosmarinicacid |
| Research Area | Natural Extract |
| Molecular Formula | C18H16O8 |
| CAS# | 20283-92-5 |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/rosmarinic-acid-item-9502.html |