(+)-JQ1 carboxylic acid
(+)-JQ1 carboxylic acid ((+)-JQ1-COOH) is a (+)-JQ1 with a carboxylic acid functional group. (+)-JQ1 carboxylic acid ((+)-JQ1-COOH) can be used as a precursor to a PROTAC that targets BET bromodomains after conjugation to a linker and E3 ligase ligand.
Trivial name | (+)-JQ1-COOH |
Catalog Number | S6993 |
Molecular Formula | C19H17ClN4O2S |
CAS# | 202592-23-2 |
Inchi | #N/A |
Inchi Key | #N/A |
SMILES | CC1=C(C)C2=C(S1)[N]3C(=NN=C3C(CC(O)=O)N=C2C4=CC=C(Cl)C=C4)C |
Size | 5mg |
Supplier Page | http://www.selleckchem.com/products/jq-1-carboxylic-acid.html |
Additional Information | https://file.selleck.cn/downloads/struct/s6993-jq-1-carboxylic-acid-chemical-structure.gif |