JQ-1 Carboxylic Acid
(+)-JQ1 carboxylic acid is a warhead ligand with a carboxylic acid functional group for conjugation reactions of PROTAC targeting on BET.
| Trivial name | (+)-JQ-1 Carboxylic Acid |
| Catalog Number | CSN18086 |
| Alternative Name(s) | (+)-JQ-1 Carboxylic Acid |
| Research Area | Cancer |
| Molecular Formula | C19H17ClN4O2S |
| CAS# | 202592-23-2 |
| Purity | ≥99% |
| SMILES | ClC1=CC=C(C(C2=C(N3C4=NN=C3C)SC(C)=C2C)=N[C@H]4CC(O)=O)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/jq-1-carboxylic-acid.html |