JANEX-1 25mg
Janex-1 is a cell-permeable, reversible, potent, ATP-competitive, and specific inhibitor of JAK3 (IC50 = 78 ??M); has no effect on JAK1, JAK2, or Zap/Syk or SRC tyrosine kinases.
| Trivial name | JANEX-1 25mg |
| Catalog Number | A15134-25 |
| Alternative Name(s) | 4-[(6, 7-dimethoxyquinazolin-4-yl)amino]phenol |
| Molecular Formula | C16H15N3O3 |
| CAS# | 202475-60-3 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)OC |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/janex-1.html |