AM 281
CB1 antagonist GPCR/G protein|Cannabinoid Receptor
| Catalog Number | B6603-5 |
| Research Area | GPCR/G protein|Cannabinoid Receptor |
| Molecular Formula | C21H19Cl2IN4O2 |
| CAS# | 202463-68-1 |
| Purity | 98.6% |
| SMILES | IC1=CC=C(C=C1)C2=C(C)C(C(NN3CCOCC3)=O)=NN2C(C(Cl)=C4)=CC=C4Cl |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6603 |
