Guanosine-13C10,15N5 | MedChemExpress (MCE)
Guanosine-13C10,15N5 is the 13C and 15N labeled Guanosine (HY-N0097). Guanosine (DL-Guanosine) is a purine nucleoside comprising guanine attached to a ribose (ribofuranose) ring via a β-N9-glycosidic bond. Guanosine possesses anti-HSV activity[1].
| Trivial name | Guanosine-13C10,15N5 |
| Catalog Number | HY-N0097S6 |
| Alternative Name(s) | DL-Guanosine-13C10,15N5; Vernine-13C10,15N5 |
| Research Area | Infection |
| CAS# | 202406-81-3 |
| Purity | ≥98.0% |
| SMILES | O=[13C]1[13C]([15N]=[13CH][15N]2[13C@@H]3O[13C@H]([13CH2]O)[13C@@H](O)[13C@H]3O)=[13C]2[15N]=[13C]([15NH2])[15NH]1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/guanosine-13c10-15n5.html |