Fluconazole is an antifungal drug.
| Catalog Number | API0232305 |
| Alternative Name(s) | 5-Fluorocytosine; flucytosine; 2022-85-7 |
| Research Area | API |
| Molecular Formula | C4H4FN3O |
| CAS# | 2022-85-7 |
| Inchi | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| Inchi Key | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| SMILES | C1=NC(=O)NC(=C1F)N |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/flucytosine-item-805.html |
Antifungal drugs, Cryptococcus spp. and Candida spp. have high antibacterial activity, and have some antibacterial activity against coloring fungi and a few Aspergillus spp.
| Catalog Number | API2022857 |
| Alternative Name(s) | 5-Fluorocytosine flucytosine Ancobon Ancotil |
| Research Area | Antibacterial APIs |
| Molecular Formula | C4H4FN3O |
| CAS# | 2022-85-7 |
| SMILES | C1=NC(=O)NC(=C1F)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/flucytosine-item-11559.html |
