α-Pompilidotoxin | MedChemExpress (MCE)
α-Pompilidotoxin (α-PMTX) is a neurotoxin that can be obtained from the venom of Anoplius safnariensis. α-Pompilidotoxin reversibly and dose-dependently enhances excitatory postsynaptic currents (EPSCs). α-Pompilidotoxin is a useful tool in the field of neuroscience research[1].
| Trivial name | α-Pompilidotoxin |
| Catalog Number | HY-P5859 |
| Alternative Name(s) | α-PMTX |
| Research Area | Neurological Disease |
| CAS# | 202075-91-0 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCCN)C(N[C@@H]([C@@H](C)CC)C(NCC(N[C@@H](CC(C)C)C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(O)=O)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CO)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCNC(N)=N)N |
| PubChem Chemical Structure ID | 101500077 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-pompilidotoxin.html |