Z-Gly-Pro-Arg-AMC hydrochloride | MedChemExpress (MCE)
Z-Gly-Pro-Arg-AMC hydrochloride a fluorescent trypsin and cathepsin K substrate. Z-Gly-Pro-Arg-AMC hydrochloride can be used to determine trypsin and cathepsin K activity[1][2].
| Trivial name | Z-Gly-Pro-Arg-AMC hydrochloride |
| Catalog Number | HY-P4217 |
| Research Area | Others |
| CAS# | 201928-42-9 |
| Purity | 98.60% |
| SMILES | CC(C1=CC=C(NC([C@H](CCCNC(N)=N)NC([C@H]2N(CCC2)C(CNC(OCC3=CC=CC=C3)=O)=O)=O)=O)C=C1O4)=CC4=O.Cl |
| PubChem Chemical Structure ID | 91873354 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/z-gly-pro-arg-amc-hydrochloride.html |