Lactate-13C-1 sodium | MedChemExpress (MCE)
Lactate-13C-1 (sodium) is the 13C labeled Lactate (sodium)[1]. Lactate (Lactic acid) sodium is the product of glycogenolysis and glycolysis. Lactate (Lactic acid) sodium functions in a variety of biochemical processes[2].
| Trivial name | Lactate-13C-1 sodium |
| Catalog Number | HY-B2227BS3 |
| Alternative Name(s) | Lactic acid-13C-1 sodium |
| Research Area | Metabolic Disease |
| CAS# | 201595-70-2 |
| Purity | ≥98.00% |
| SMILES | O=C(O[Na])[C@@H](O)[13CH3] |
| PubChem Chemical Structure ID | 23696283 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lactate-13c-1-sodium.html |