Deferasirox 10mM * 1mL in DMSO
Deferasirox is a rationally-designed oral iron chelator. Its main use is to reduce chronic iron overload in patients who are receiving long-term blood transfusions for conditions such as beta-thalassemia and other chronic anemias.
| Trivial name | Deferasirox 10mM * 1mL in DMSO |
| Catalog Number | A10293-10mM-D |
| Alternative Name(s) | [4-[(3Z,5E)-3,5-bis(6-oxo-1-cyclohexa-2,4-dienylidene)-1,2,4-triazolidin-1-yl]benzoic acid |
| Molecular Formula | C21H15N3O4 |
| CAS# | 201530-41-8 |
| SMILES | C1=C/C(=C2/N/C(=C3/C=CC=CC3=O)/N(N2)C4=CC=C(C=C4)C(=O)O)/C(=O)C=C1 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/deferasirox.html |
