Tenofovir Disoproxil
Tenofovir dsoproxil acts as an anti-HIV agent and a reverse transcriptase inhibitor that is used to prevent HIV/AIDS and chronic hepatitis B.

Trivial name | GS-1278 Disoproxil |
Catalog Number | CSN12598 |
Alternative Name(s) | GS-1278 Disoproxil |
Research Area | Infection |
Molecular Formula | C19H30N5O10P |
CAS# | 201341-05-1 |
Purity | ≥99% |
SMILES | O=C(OC(C)C)OCOP(OCOC(OC(C)C)=O)(CO[C@H](C)CN1C=NC2=C(N)N=CN=C12)=O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/tenofovir-disoproxil.html |