2-Oxo Prasugrel D4 Hydrochloride
Stable isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16005 |
| Alternative Name(s) | 5-{2-cyclopropyl-1-[2-fluoro(3,4,5,6-D₄)phenyl]-2-oxoethyl}-2H,4H,5H,6H,7H,7aH-thieno[3,2-c]pyridin-2-one hydrochloride |
| Research Area | Labeled Prasugrel, intended for use as an internal standard for the quantification of Prasugrel by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H15D4ClFNO2S |
| CAS# | 2012598-55-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1CC1)C(C(C([2H])=C2[2H])=C(C([2H])=C2[2H])F)N(CCC3S4)CC3=CC4=O.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16005.html |
| Additional Information | NULL |