Arformoterol Tartrate
Arformoterol Tartrate, can be used in the synthesis of Omeprazole , which is a proton pump inhibitor, that inhibits gasteric secretion, also used in the treatment of dyspepsia, peptic ulcer disease, etc. Itis also the impurity of Esomeprazole Ma;Impurity in commercial preparations of Arformoterol
| Catalog Number | CS-O-00839 |
| Alternative Name(s) | N-[2-Hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino] ethyl]phenyl]formamide (+)-(2R,3R)-Tartarc cid; (-)-Formoterol 1,2-Dihydroxyethane-1,2-dcarboxylc cid; (R,R)-Formoterol Threarc cid; Arformoterol d-Tartarc cid; Arformoterol d-α,β-Dihydroxysccinc cid; |
| Molecular Formula | C23H30N2O10 |
| CAS# | 200815-49-2 |
| Purity | >98% |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.O[C@H](C1=CC(NC=O)=C(O)C=C1)CN[C@H](C)CC2=CC=C(OC)C=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00839.html |
