(E)-3-(Naphth-1-yl)acrylic acid
(E)-3-(Naphth-1-yl)acrylic acid is a biochemical reagent that can be used to synthesize a variety of compounds and participate in many reactions in the body.
| Catalog Number | T77682 |
| Alternative Name(s) | 3-(1-Naphthyl)acrylic acid |
| Research Area | Others |
| Molecular Formula | C13H10O2 |
| CAS# | 2006-14-6 |
| SMILES | C(=C/C(O)=O)\C=1C2=C(C=CC1)C=CC=C2 |
| Size | 500 mg |
| Supplier Page | https://www.targetmol.com/compound/_e_3_naphth_1_yl_acrylic_acid |
| Additional Information | https://www.targetmol.com/datasheet/T77682 |