ML329
ML329 is a small molecule inhibitor of MITF, inhibiting TRPM-1 promoter activity.
| Catalog Number | T4028 |
| Research Area | Membrane transporter/Ion channel |
| Molecular Formula | C16H12N2O4S |
| CAS# | 19992-50-8 |
| SMILES | c1(ccc(cc1)NC1=CC(=O)c2ccccc2C1=O)S(=O)(=O)N |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/ML329 |
| Additional Information | https://www.targetmol.com/datasheet/T4028 |
