Eicosapentaenoyl serotonin | MedChemExpress (MCE)
Eicosapentaenoyl serotonin (EPA-5-HT) is an N-acyl serotonin, a novel lipid present in the gut. Eicosapentaenoyl serotonin inhibits glucagon-like peptide-1 secretion and FAAH activity[1].
| Trivial name | Eicosapentaenoyl serotonin |
| Catalog Number | HY-127023 |
| Alternative Name(s) | EPA-5-HT |
| Research Area | Metabolic Disease |
| CAS# | 199875-71-3 |
| Purity | ≥99.0% |
| SMILES | O=C(CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)NCCC1=CNC2=CC=C(C=C12)O |
| Size | 1 mg（21.71 mM * 100 μL in Etha |
| Supplier Page | https://www.medchemexpress.com/eicosapentaenoyl-serotonin.html |