Stattic
Stattic, a nonpeptidic small molecule, potently inhibits STAT3 activation and nuclear translocation with IC50 of 5.1 μM in cell-free assays, highly selectivity over STAT1.
| Trivial name | STAT3 Inhibitor V |
| Catalog Number | CSN10157 |
| Alternative Name(s) | STAT3 Inhibitor V |
| Research Area | Cancer |
| Molecular Formula | C8H5NO4S |
| CAS# | 19983-44-9 |
| Purity | ≥99% |
| SMILES | O=[N+](C1=CC=C(C=CS2(=O)=O)C2=C1)[O-] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/stattic.html |