Cilengitide trifluoroacetate 5mg
Cilengitide is a cyclic Arg-Gly-Asp peptide with potential antineoplastic activity. Cilengitide binds to and inhibits the activities of the alpha(v)beta(3) and alpha(v)beta(5) integrins, thereby inhibiting endothelial cell-cell interactions, endothelial cell-matrix interactions, and angiogenesis.
Trivial name | Cilengitide trifluoroacetate 5mg |
Catalog Number | A12371-5 |
Alternative Name(s) | 2-((2S,5R,8S,11S)-5-benzyl-11-(3-((diaminomethylene)amino)propyl)-8-isopropyl-7-methyl-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentaazacyclopentadecan-2-yl)acetic acid |
Molecular Formula | C29H41N8O9F3 |
CAS# | 199807-35-7 |
SMILES | CC(C)[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](C(=O)N1C)Cc2ccccc2)CC(=O)O)CCCNC(=N)N.C(=O)(C(F)(F)F)O |
Size | 5mg |
Supplier Page | http://www.adooq.com/cilengitide-trifluoroacetate.html |