CADD522
CADD522 is a small molecule that inhibits the DNA binding of RUNX2. It negatively regulated transcription of RUNX2 target genes such as matrix metalloproteinase-13, vascular endothelial growth factor and glucose transporter-1, but upregulated RUNX2 expression by increasing RUNX2 stability. CADD522 may represent a potential antitumor drug.
Trivial name | MFCD00167693 |
Catalog Number | CSN25632 |
Alternative Name(s) | MFCD00167693 |
Research Area | Cancer |
Molecular Formula | C15H13Cl2NO3 |
CAS# | 199735-88-1 |
Purity | ≥98% |
SMILES | O=C(O)C1C2CC(C1C(NC3=CC=C(C(Cl)=C3)Cl)=O)C=C2 |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/cadd522.html |