Canagliflozin D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10809 |
| Alternative Name(s) | (2S,3R,4R,5S,6R)-2-[3-({5-[4-fluoro(2,3,5,6-D4)phenyl]thiophen-2-yl}methyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Research Area | Labeled Canagliflozin; Canagliflozin Stable Isotope;Labeled Canagliflozin, intended for use as an internal standard for the quantification of Canagliflozin by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H21D4FO5S |
| CAS# | 1997338-61-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]1[C@H](C2=CC(CC3=CC=C(C(C([2H])=C4[2H])=C(C([2H])=C4F)[2H])S3)=C(C)C=C2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10809.html |
| Additional Information | NULL |