Ro 61-8048
Ro 61-8048 is an inhibitor of kynurenine 3-hydroxylase which can potently and competitively inhibit kynurenine 3-monooxygenase with Ki value and IC50 value of 4.8 nM and 37 nM, respectively.
| Trivial name | / |
| Catalog Number | CSN13615 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C17H15N3O6S2 |
| CAS# | 199666-03-0 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(OC)C(OC)=C1)(NC2=NC(C3=CC=CC([N+]([O-])=O)=C3)=CS2)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ro-61-8048.html |
