Kolavenol | MedChemExpress (MCE)
Kolavenol is a diterpene, which can be isolated from Entada abyssinica. Kolavenol’s diastereoisomer exhibits trypanocidal activity with an IC50 value of 2.5 μg/mL (8.6 μM) against Trypanosoma brucei rhodesiense. While Trypanosoma brucei rhodesiense is the causing factor of the acute form of human African trypanosomiasis[1].
| Trivial name | Kolavenol |
| Catalog Number | HY-N3418 |
| Research Area | Infection |
| CAS# | 19941-83-4 |
| Purity | ≥98.00% |
| SMILES | OC/C=C(C)/CC[C@@]1([C@]2([H])[C@@](CC[C@H]1C)(C(C)=CCC2)C)C |
| PubChem Chemical Structure ID | 6442554 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kolavenol.html |