Lugdunin | MedChemExpress (MCE)
Lugdunin is an antibiotic peptide. Lugdunin inhibits bacteria by dissipating their membrane potential. Lugdunin is active against Gram-positive bacteria, such as S. aureus, and reduces S. aureus skin and nasal colonization. Lugdunin induces LL-37 and CXCL8/MIP-2 in human keratinocytes and mouse skin[1].
| Trivial name | Lugdunin |
| Catalog Number | HY-P4200 |
| Research Area | Infection |
| CAS# | 1989698-37-4 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H](C(N[C@H](C(N[C@@H](C(N[C@H](C1([H])N[C@](CS1)([H])C(N[C@@H](C(N2)=O)C(C)C)=O)C(C)C)=O)C(C)C)=O)C(C)C)=O)CC(C)C)[C@@H]2CC3=CNC4=CC=CC=C34 |
| PubChem Chemical Structure ID | 121596231 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lugdunin.html |