Isatoribine monohydrate 25mg
Isatoribine monohydrate is a novel guanosine analogue showing immunostimulatory activity both in vivo and in vitro. This compound acts on different components of the immune system including B cells, natural killer (NK) cells and antigen-presenting cells (APC).
| Trivial name | Isatoribine monohydrate 25mg |
| Catalog Number | A13520-25 |
| Alternative Name(s) | 5-amino-3-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)thiazolo[4,5-d]pyrimidine-2,7(3H,6H)-dione hydrate |
| Molecular Formula | C10H14N4O7S |
| CAS# | 198832-38-1 |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C3=C(C(=O)N=C(N3)N)SC2=O)O)O)O.O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/isatoribine-monohydrate.html |
