Cabralealactone
Cabralealactone, a natural product isolated and purified from the herbs of Aglaia lawii, is exclusively cytotoxic to NCI-H187 cell line, displayes minimum inhibitory concentration in the range of 25-50 µg mL(-1).
| Trivial name | / |
| Catalog Number | CSN14512 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C27H42O3 |
| CAS# | 19865-87-3 |
| Purity | ≥98% |
| SMILES | C[C@@]12[C@@]([H])([C@]3(C)[C@@]([H])(CC2)C(C(CC3)=O)(C)C)CC[C@]4([C@@]1(C)CC[C@@]4([C@@]5(C)OC(CC5)=O)[H])[H] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/cabralealactone.html |