Parecoxib Sodium
Parecoxib Sodium, a water-soluble and injectable prodrug of valdecoxib, is a COX2 inhibitor used for the short-term treatment of postoperative pain in adults.
| Trivial name | SC 69124A |
| Catalog Number | CSN12368 |
| Alternative Name(s) | SC 69124A |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C19H17N2NaO4S |
| CAS# | 198470-85-8 |
| Purity | ≥99% |
| SMILES | CCC([N-]S(=O)(C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)C)=O)=O.[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/parecoxib-sodium.html |