Trilexium | MedChemExpress (MCE)
Trilexium (TRX-E-009-1) is a third-generation of benzopyran structurally related to TRX-E-002-1 (HY-114250). Trilexium increases p21 protein expression and induces apoptosis. Trilexium depolymerizes microtubules. Trilexium shows broad anti-cancer activity[1][2].
| Trivial name | Trilexium |
| Catalog Number | HY-157800 |
| Alternative Name(s) | TRX-E-009-1 |
| Research Area | Cancer |
| CAS# | 1983180-82-0 |
| Purity | 99.7% |
| SMILES | OC1=C(OC)C=C([C@H]2[C@@H](C3=CC(F)=C(C=C3)O)C4=CC=C(O)C(C)=C4OC2)C=C1OC |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/trilexium.html |