Ramelteon (TAK-375) 10mM * 1mL in DMSO
Ramelteon is a melatonin receptor agonist with both high affinity for melatonin MT1 (IC50 =28.5 ?? 8.55 pM)and MT2 (20.1 ?? 9.25 pM)receptors and selectivity over the MT3 receptor.
| Trivial name | Ramelteon (TAK-375) 10mM * 1mL in DMSO |
| Catalog Number | A10777-10mM-D |
| Alternative Name(s) | (S)-N-[2-(1,6,7,8-tetrahydro-2H-indeno-[5,4-b] furan-8-yl)ethyl]propionamide |
| Molecular Formula | C16H21NO2 |
| CAS# | 196597-26-9 |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ramelteon-tak-375.html |
