(3β,7β,12β,20Z)-3,7,12-Trihydroxy-11,15,23-trioxo-lanost-8,20-dien-26-oic acid
(3β,7β,12β,20Z)-3,7,12-Trihydroxy-11,15,23-trioxo-lanost-8,20-dien-26-oic acid, a lanostane triterpenoid, demonstrates significant inhibitory effects on nitric oxide (NO) production in BV-2 microglia cells induced by n LPS, with an IC50 value of 9.55 uM. Moreover, this compound possesses anti-inflammatory properties.
| Catalog Number | T39386 |
| Molecular Formula | C30H42O8 |
| CAS# | 1961358-02-0 |
| SMILES | C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)[C@@H](O)[C@]1(C)[C@@H](\C(=C/C(CC(C(O)=O)C)=O)\C)CC2=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/1961358-02-0 |
| Additional Information | https://www.targetmol.com/datasheet/T39386 |
