(R)-Nepicastat HCl
(R)-Nepicastat HCl (RS-25560-198), the R-enantiomer of Nepicastat HCl, is a potent and selective inhibitor with IC50 of 25.1 nM and 18.3 nM for bovine and human dopamine-β-hydroxylase, with negligible affinity for twelve other enzymes and thirteen neurotransmitter receptors.
| Trivial name | RS-25560-198 HCl |
| Catalog Number | S4926 |
| Molecular Formula | C18H15ClN4O2 |
| CAS# | 195881-94-8 |
| Inchi | InChI=1S/C18H15ClN4O2/c1-10(21-16-6-4-13(9-20)23(2)18(16)25)14-8-11-7-12(19)3-5-15(11)22-17(14)24/h3-8,10,21H,1-2H3,(H,22,24)/t10-/m0/s1 |
| Inchi Key | NEQYWYXGTJDAKR-JTQLQIEISA-N |
| SMILES | CC(C1=CC2=C(C=CC(=C2)Cl)NC1=O)NC3=CC=C(N(C3=O)C)C#N |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/r-nepicastat-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/R-Nepicastat-HCl-chemical-structure-s4926.gif |