AP1903
AP1903 is a homodimer binding to FKBP and elicites potent and dosedependent apoptotic death of engineered cell line HT1080 in culture with an EC50 of 0.1 nM.
| Trivial name | Rimiducid |
| Catalog Number | CSN18073 |
| Alternative Name(s) | Rimiducid |
| Research Area | Cancer |
| Molecular Formula | C78H98N4O20 |
| CAS# | 195514-63-7 |
| Purity | ≥98% |
| SMILES | O=C(N1[C@@H](CCCC1)C(O[C@@H](C2=CC(OCC(NCCNC(COC3=CC([C@@H](CCC4=CC(OC)=C(C=C4)OC)OC([C@H]5N(CCCC5)C([C@H](C6=CC(OC)=C(C(OC)=C6)OC)CC)=O)=O)=CC=C3)=O)=O)=CC=C2)CCC7=CC(OC)=C(C=C7)OC)=O)[C@H](C8=CC(OC)=C(C(OC)=C8)OC)CC |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ap1903.html |