N-Acetyl-S-benzyl-L-Cysteine
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-02001 |
| Alternative Name(s) | (2R)-3-(benzylsulfanyl)-c acid;N-Acetyl-S-(phenylmethyl)-L-cysteine |
| Research Area | A metabolite of Toluene |
| Molecular Formula | C12H15NO3S |
| CAS# | 19542-77-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@@H](NC(C)=O)CSCC1=CC=CC=C1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02001.html |
| Additional Information | NULL |