BAY 11-7082
BAY 11-7082 is a NF-κB inhibitor, inhibits TNFα-induced IκBα phosphorylation with IC50 of 10 μM in tumor cells. It also inhibits components of the ubiquitin system through inactivating the E2-conjugating enzymes Ubc (ubiquitin conjugating) 13 and UbcH7 and the E3 ligase LUBAC (linear ubiquitin assembly complex).
| Trivial name | (E)-3-Tosylacrylonitrile |
| Catalog Number | CSN13487 |
| Alternative Name(s) | (E)-3-Tosylacrylonitrile |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C10H9NO2S |
| CAS# | 19542-67-7 |
| Purity | ≥99% |
| SMILES | N#C/C=C/S(=O)(C1=CC=C(C)C=C1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/bay-11-7082.html |