γ-Glu-Gly
γ-Glu-Gly, a γ-glutamyl dipeptide, is a human lipid metabolite with a structure resembling that of GABA (γ-aminobutyric acid). It functions as an antagonist of excitatory amino acids.
| Catalog Number | T39359 |
| Alternative Name(s) | gamma-Glutamylglycine |
| Research Area | Metabolism |
| Molecular Formula | C7H12N2O5 |
| CAS# | 1948-29-4 |
| SMILES | C(C(NCC(O)=O)=O)C[C@@H](C(O)=O)N |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/γ-glu-gly |
| Additional Information | https://www.targetmol.com/datasheet/T39359 |