(Z)-Semaxinib
Semaxanib (SU5416) is a potent and selective VEGFR(Flk-1/KDR) inhibitor (IC50: 1.23 μM), 20-fold more selective for VEGFR over PDGFRβ, no inhibition for FGFR, InsR, and EGFR. Semaxanib is a quinolone derivative with potential antineoplastic activity.
| Catalog Number | T2496 |
| Alternative Name(s) | SU5416 |
| Research Area | Angiogenesis|||Tyrosine Kinase/Adaptors |
| Molecular Formula | C15H14N2O |
| CAS# | 194413-58-6 |
| SMILES | Cc1cc(C)c(\C=C2/C(=O)Nc3ccccc23)[nH]1 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/(Z)-Semaxinib |
| Additional Information | https://www.targetmol.com/datasheet/T2496 |