Selinidin
Selinidin, a natural product isolated and purified from the herbs of Peucedanum harry-smithii var. subglabrum, decreases phosphorylation of phospholipase C-gamma1, p38 mitogen-activated protein kinase, and IkappaB-alpha upon FcepsilonRI stimulation.
| Trivial name | / |
| Catalog Number | CSN14221 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C19H20O5 |
| CAS# | 19427-82-8 |
| Purity | ≥98% |
| SMILES | C/C=C(C)\C(O[C@H]1CC2=C3C(C=CC(O3)=O)=CC=C2OC1(C)C)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/selinidin.html |